C19H27FO7 — CID 143220806
(1S,5S,7R,9R,13R,14R)-5-fluoro-9-methoxy-5,7,13-trimethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 143220806) has the molecular formula C19H27FO7 and a molecular weight of 386.42 g/mol. Its IUPAC name is (1S,5S,7R,9R,13R,14R)-5-fluoro-9-methoxy-5,7,13-trimethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,5S,7R,9R,13R,14R)-5-fluoro-9-methoxy-5,7,13-trimethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 143220806 |
| Molecular Formula | C19H27FO7 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (1S,5S,7R,9R,13R,14R)-5-fluoro-9-methoxy-5,7,13-trimethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CO[C@@H]1CCC(=O)[C@H](C)[C@H]2CC(=O)O[C@@H]2COC(=O)[C@@](C)(F)C(=O)[C@H](C)C1 |
| InChI | InChI=1S/C19H27FO7/c1-10-7-12(25-4)5-6-14(21)11(2)13-8-16(22)27-15(13)9-26-18(24)19(3,20)17(10)23/h10-13,15H,5-9H2,1-4H3/t10-,11-,12-,13-,15-,19+/m1/s1 |
| InChIKey | FDVVHIBAGXGRRT-PFIUMFQQSA-N |
| XLogP | 1.80 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|