C26H42O7 — CID 59154572
(1S,2R,5R,7R,8R,9R,11R,14R)-2,14-diethyl-9-methoxy-1,5,7,8,9,11-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 59154572) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,9R,11R,14R)-2,14-diethyl-9-methoxy-1,5,7,8,9,11-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,2R,5R,7R,8R,9R,11R,14R)-2,14-diethyl-9-methoxy-1,5,7,8,9,11-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 59154572 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (1S,2R,5R,7R,8R,9R,11R,14R)-2,14-diethyl-9-methoxy-1,5,7,8,9,11-hexamethyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](C)[C@](C)(OC)C[C@@H](C)C(=O)C[C@]2(CC)CC(=O)O[C@]12C |
| InChI | InChI=1S/C26H42O7/c1-10-20-25(8)26(11-2,14-21(28)33-25)13-19(27)15(3)12-24(7,31-9)18(6)16(4)22(29)17(5)23(30)32-20/h15-18,20H,10-14H2,1-9H3/t15-,16-,17-,18-,20-,24-,25-,26-/m1/s1 |
| InChIKey | QAWPPPKIAOKNMT-GYTPFYLFSA-N |
| XLogP | 4.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|