C19H28O9 — CID 134867413
diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]propanedioate (PubChem CID 134867413) has the molecular formula C19H28O9 and a molecular weight of 400.42 g/mol. Its IUPAC name is diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]propanedioate |
|---|---|
| PubChem CID | 134867413 |
| Molecular Formula | C19H28O9 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@@H]1C(=O)CC[C@H]1C(COC(C)=O)OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H28O9/c1-5-25-18(23)15(19(24)26-6-2)9-14-13(7-8-16(14)22)17(28-12(4)21)10-27-11(3)20/h13-15,17H,5-10H2,1-4H3/t13-,14+,17?/m1/s1 |
| InChIKey | HGJDSVWXLPYQIQ-LICQEQMYSA-N |
| XLogP | 1.21 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|