C12H19FO3S2 — CID 11616326
ethyl 2-[(1S,2R)-2-ethoxycarbothioylsulfanylcyclopentyl]-2-fluoroacetate (PubChem CID 11616326) has the molecular formula C12H19FO3S2 and a molecular weight of 294.41 g/mol. Its IUPAC name is ethyl 2-[(1S,2R)-2-ethoxycarbothioylsulfanylcyclopentyl]-2-fluoroacetate.
| Compound Name | ethyl 2-[(1S,2R)-2-ethoxycarbothioylsulfanylcyclopentyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 11616326 |
| Molecular Formula | C12H19FO3S2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 2-[(1S,2R)-2-ethoxycarbothioylsulfanylcyclopentyl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)[C@@H]1CCC[C@H]1SC(=S)OCC |
| InChI | InChI=1S/C12H19FO3S2/c1-3-15-11(14)10(13)8-6-5-7-9(8)18-12(17)16-4-2/h8-10H,3-7H2,1-2H3/t8-,9-,10?/m1/s1 |
| InChIKey | TZMLTZNAQZYCHO-MGRQHWMJSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|