C15H19Cl2NO — CID 11616396
(1R,5S)-3-(3,4-dichlorophenoxy)-9-methyl-9-azabicyclo[3.3.1]nonane (PubChem CID 11616396) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is (1R,5S)-3-(3,4-dichlorophenoxy)-9-methyl-9-azabicyclo[3.3.1]nonane.
| Compound Name | (1R,5S)-3-(3,4-dichlorophenoxy)-9-methyl-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 11616396 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (1R,5S)-3-(3,4-dichlorophenoxy)-9-methyl-9-azabicyclo[3.3.1]nonane |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(Oc1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C15H19Cl2NO/c1-18-10-3-2-4-11(18)8-13(7-10)19-12-5-6-14(16)15(17)9-12/h5-6,9-11,13H,2-4,7-8H2,1H3/t10-,11+,13? |
| InChIKey | WCZPEYBNUDTXAI-QYJAPNMZSA-N |
| XLogP | 4.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |