About 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one
4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one (PubChem CID 11536732) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one.
Molecular Properties
| Compound Name | 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one |
| PubChem CID | 11536732 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2ccc(OC3C[C@@H]4CC[C@@H](C3)N4C)cc12 |
| InChI | InChI=1S/C18H21NO3/c1-11-7-18(20)22-17-6-5-14(10-16(11)17)21-15-8-12-3-4-13(9-15)19(12)2/h5-7,10,12-13,15H,3-4,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | PTFVDKBLZRDDAD-STQMWFEESA-N |
| XLogP | 3.11 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one?
The IUPAC name of 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one (CID 11536732) is 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one.
What is the SMILES notation for 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one?
The canonical SMILES for 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one is Cc1cc(=O)oc2ccc(OC3C[C@@H]4CC[C@@H](C3)N4C)cc12.
What is the InChIKey of 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one?
The InChIKey is PTFVDKBLZRDDAD-STQMWFEESA-N. The full InChI is InChI=1S/C18H21NO3/c1-11-7-18(20)22-17-6-5-14(10-16(11)17)21-15-8-12-3-4-13(9-15)19(12)2/h5-7,10,12-13,15H,3-4,8-9H2,1-2H3/t12-,13-/m0/s1.
What are the key properties of 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one?
4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one has a molecular weight of 299.37 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-[[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]chromen-2-one is sourced from PubChem (CID 11536732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).