C22H29FN2O — CID 11617371
(2R)-1-(2-fluorophenyl)-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]butan-2-amine (PubChem CID 11617371) has the molecular formula C22H29FN2O and a molecular weight of 356.48 g/mol. Its IUPAC name is (2R)-1-(2-fluorophenyl)-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]butan-2-amine.
| Compound Name | (2R)-1-(2-fluorophenyl)-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]butan-2-amine |
|---|---|
| PubChem CID | 11617371 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (2R)-1-(2-fluorophenyl)-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]butan-2-amine |
| SMILES | N[C@@H](CCN1CCC[C@H]1COCc1ccccc1)Cc1ccccc1F |
| InChI | InChI=1S/C22H29FN2O/c23-22-11-5-4-9-19(22)15-20(24)12-14-25-13-6-10-21(25)17-26-16-18-7-2-1-3-8-18/h1-5,7-9,11,20-21H,6,10,12-17,24H2/t20-,21-/m0/s1 |
| InChIKey | WBLNMKBCPBWCTL-SFTDATJTSA-N |
| XLogP | 3.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |