C29H34F2N2O — CID 10600218
N-[[(2S)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidin-2-yl]methyl]-3-phenylpropan-1-amine (PubChem CID 10600218) has the molecular formula C29H34F2N2O and a molecular weight of 464.60 g/mol. Its IUPAC name is N-[[(2S)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidin-2-yl]methyl]-3-phenylpropan-1-amine.
| Compound Name | N-[[(2S)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidin-2-yl]methyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 10600218 |
| Molecular Formula | C29H34F2N2O |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[[(2S)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidin-2-yl]methyl]-3-phenylpropan-1-amine |
| SMILES | Fc1ccc(C(OCCN2CCC[C@H]2CNCCCc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H34F2N2O/c30-26-14-10-24(11-15-26)29(25-12-16-27(31)17-13-25)34-21-20-33-19-5-9-28(33)22-32-18-4-8-23-6-2-1-3-7-23/h1-3,6-7,10-17,28-29,32H,4-5,8-9,18-22H2/t28-/m0/s1 |
| InChIKey | RNMMMKSJGRTVQB-NDEPHWFRSA-N |
| XLogP | 5.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|