About N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride
N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride (PubChem CID 11617826) has the molecular formula C21H18ClN3O2
and a molecular weight of 379.85 g/mol. Its IUPAC name is N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride.
Molecular Properties
| Compound Name | N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride |
| PubChem CID | 11617826 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccccc1/C(=C/C=N/c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H17N3O2.ClH/c25-24(26)21-14-8-7-13-19(21)20(23-18-11-5-2-6-12-18)15-16-22-17-9-3-1-4-10-17;/h1-16,23H;1H/b20-15-,22-16+; |
| InChIKey | NDTFONWIJUWPGX-KERKHADCSA-N |
| XLogP | 5.87 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride?
The IUPAC name of N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride (CID 11617826) is N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride.
What is the SMILES notation for N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride?
The canonical SMILES for N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride is Cl.O=[N+]([O-])c1ccccc1/C(=C/C=N/c1ccccc1)Nc1ccccc1.
What is the InChIKey of N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride?
The InChIKey is NDTFONWIJUWPGX-KERKHADCSA-N. The full InChI is InChI=1S/C21H17N3O2.ClH/c25-24(26)21-14-8-7-13-19(21)20(23-18-11-5-2-6-12-18)15-16-22-17-9-3-1-4-10-17;/h1-16,23H;1H/b20-15-,22-16+;.
What are the key properties of N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride?
N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride has a molecular weight of 379.85 g/mol, XLogP of 5.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(2-nitrophenyl)-3-phenyliminoprop-1-enyl]aniline;hydrochloride is sourced from PubChem (CID 11617826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).