C7H6Cl2N4O — CID 11622761
2-chloro-1-(tetrazolo[1,5-a]pyridin-6-yl)ethanone;hydrochloride (PubChem CID 11622761) has the molecular formula C7H6Cl2N4O and a molecular weight of 233.06 g/mol. Its IUPAC name is 2-chloro-1-(tetrazolo[1,5-a]pyridin-6-yl)ethanone;hydrochloride.
| Compound Name | 2-chloro-1-(tetrazolo[1,5-a]pyridin-6-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 11622761 |
| Molecular Formula | C7H6Cl2N4O |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 2-chloro-1-(tetrazolo[1,5-a]pyridin-6-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CCl)c1ccc2nnnn2c1 |
| InChI | InChI=1S/C7H5ClN4O.ClH/c8-3-6(13)5-1-2-7-9-10-11-12(7)4-5;/h1-2,4H,3H2;1H |
| InChIKey | LGTICXRLUBXBKN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|