About tetrazolo[1,5-a]pyridine-7-carboxamide
tetrazolo[1,5-a]pyridine-7-carboxamide (PubChem CID 140609958) has the molecular formula C6H5N5O
and a molecular weight of 163.14 g/mol. Its IUPAC name is tetrazolo[1,5-a]pyridine-7-carboxamide.
Molecular Properties
| Compound Name | tetrazolo[1,5-a]pyridine-7-carboxamide |
| PubChem CID | 140609958 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | tetrazolo[1,5-a]pyridine-7-carboxamide |
| SMILES | NC(=O)c1ccn2nnnc2c1 |
| InChI | InChI=1S/C6H5N5O/c7-6(12)4-1-2-11-5(3-4)8-9-10-11/h1-3H,(H2,7,12) |
| InChIKey | SFFQYOHRLGISSK-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tetrazolo[1,5-a]pyridine-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazolo[1,5-a]pyridine-7-carboxamide?
The IUPAC name of tetrazolo[1,5-a]pyridine-7-carboxamide (CID 140609958) is tetrazolo[1,5-a]pyridine-7-carboxamide.
What is the SMILES notation for tetrazolo[1,5-a]pyridine-7-carboxamide?
The canonical SMILES for tetrazolo[1,5-a]pyridine-7-carboxamide is NC(=O)c1ccn2nnnc2c1.
What is the InChIKey of tetrazolo[1,5-a]pyridine-7-carboxamide?
The InChIKey is SFFQYOHRLGISSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O/c7-6(12)4-1-2-11-5(3-4)8-9-10-11/h1-3H,(H2,7,12).
What are the key properties of tetrazolo[1,5-a]pyridine-7-carboxamide?
tetrazolo[1,5-a]pyridine-7-carboxamide has a molecular weight of 163.14 g/mol, XLogP of -0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazolo[1,5-a]pyridine-7-carboxamide is sourced from PubChem (CID 140609958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).