C17H20O5 — CID 11623641
diethyl 2-[(1R,2R)-2-formyl-2,3-dihydro-1H-inden-1-yl]propanedioate (PubChem CID 11623641) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-formyl-2,3-dihydro-1H-inden-1-yl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R)-2-formyl-2,3-dihydro-1H-inden-1-yl]propanedioate |
|---|---|
| PubChem CID | 11623641 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-formyl-2,3-dihydro-1H-inden-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1c2ccccc2C[C@H]1C=O |
| InChI | InChI=1S/C17H20O5/c1-3-21-16(19)15(17(20)22-4-2)14-12(10-18)9-11-7-5-6-8-13(11)14/h5-8,10,12,14-15H,3-4,9H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | GSRFIPIXROCETC-JSGCOSHPSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|