C15H18O2 — CID 170021750
ethyl (2S)-2-(2-methylidene-1,3-dihydroinden-1-yl)propanoate (PubChem CID 170021750) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is ethyl (2S)-2-(2-methylidene-1,3-dihydroinden-1-yl)propanoate.
| Compound Name | ethyl (2S)-2-(2-methylidene-1,3-dihydroinden-1-yl)propanoate |
|---|---|
| PubChem CID | 170021750 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | ethyl (2S)-2-(2-methylidene-1,3-dihydroinden-1-yl)propanoate |
| SMILES | C=C1Cc2ccccc2C1[C@H](C)C(=O)OCC |
| InChI | InChI=1S/C15H18O2/c1-4-17-15(16)11(3)14-10(2)9-12-7-5-6-8-13(12)14/h5-8,11,14H,2,4,9H2,1,3H3/t11-,14?/m0/s1 |
| InChIKey | WINLILPFAPHPDV-ZSOXZCCMSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|