C24H28O4 — CID 68612475
3-(9,10-dihydroanthracen-9-yl)-4-hexan-3-yloxy-4-oxobutanoic acid (PubChem CID 68612475) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-(9,10-dihydroanthracen-9-yl)-4-hexan-3-yloxy-4-oxobutanoic acid.
| Compound Name | 3-(9,10-dihydroanthracen-9-yl)-4-hexan-3-yloxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68612475 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-(9,10-dihydroanthracen-9-yl)-4-hexan-3-yloxy-4-oxobutanoic acid |
| SMILES | CCCC(CC)OC(=O)C(CC(=O)O)C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C24H28O4/c1-3-9-18(4-2)28-24(27)21(15-22(25)26)23-19-12-7-5-10-16(19)14-17-11-6-8-13-20(17)23/h5-8,10-13,18,21,23H,3-4,9,14-15H2,1-2H3,(H,25,26) |
| InChIKey | XGZYWXANTHEUTL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |