C18H32OSi2 — CID 11623918
trimethyl-[2-prop-2-enyl-3-(4-trimethylsilylbut-3-ynyl)cyclopenten-1-yl]oxysilane (PubChem CID 11623918) has the molecular formula C18H32OSi2 and a molecular weight of 320.63 g/mol. Its IUPAC name is trimethyl-[2-prop-2-enyl-3-(4-trimethylsilylbut-3-ynyl)cyclopenten-1-yl]oxysilane.
| Compound Name | trimethyl-[2-prop-2-enyl-3-(4-trimethylsilylbut-3-ynyl)cyclopenten-1-yl]oxysilane |
|---|---|
| PubChem CID | 11623918 |
| Molecular Formula | C18H32OSi2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | trimethyl-[2-prop-2-enyl-3-(4-trimethylsilylbut-3-ynyl)cyclopenten-1-yl]oxysilane |
| SMILES | C=CCC1=C(O[Si](C)(C)C)CCC1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H32OSi2/c1-8-11-17-16(12-9-10-15-20(2,3)4)13-14-18(17)19-21(5,6)7/h8,16H,1,9,11-14H2,2-7H3 |
| InChIKey | ROPLRJHBEGVPHN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|