C15H18ClNO4S — CID 11624336
ethyl 6-[(3-chlorophenyl)sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 11624336) has the molecular formula C15H18ClNO4S and a molecular weight of 343.83 g/mol. Its IUPAC name is ethyl 6-[(3-chlorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(3-chlorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11624336 |
| Molecular Formula | C15H18ClNO4S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | ethyl 6-[(3-chlorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO4S/c1-2-21-15(18)13-8-3-4-9-14(13)22(19,20)17-12-7-5-6-11(16)10-12/h5-8,10,14,17H,2-4,9H2,1H3 |
| InChIKey | PXCWEJCDNIBFMX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |