C22H20N4OS — CID 11625250
1-(1-benzothiophen-3-yl)-N-(1,6-naphthyridin-4-yl)piperidine-4-carboxamide (PubChem CID 11625250) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-(1,6-naphthyridin-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-(1,6-naphthyridin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 11625250 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-(1,6-naphthyridin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccnc2ccncc12)C1CCN(c2csc3ccccc23)CC1 |
| InChI | InChI=1S/C22H20N4OS/c27-22(25-19-6-10-24-18-5-9-23-13-17(18)19)15-7-11-26(12-8-15)20-14-28-21-4-2-1-3-16(20)21/h1-6,9-10,13-15H,7-8,11-12H2,(H,24,25,27) |
| InChIKey | HFXYFICZWKMXQM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |