C23H21N5O — CID 58653171
N-(2,7-naphthyridin-4-yl)-1-quinolin-3-ylpiperidine-4-carboxamide (PubChem CID 58653171) has the molecular formula C23H21N5O and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(2,7-naphthyridin-4-yl)-1-quinolin-3-ylpiperidine-4-carboxamide.
| Compound Name | N-(2,7-naphthyridin-4-yl)-1-quinolin-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58653171 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-(2,7-naphthyridin-4-yl)-1-quinolin-3-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cncc2cnccc12)C1CCN(c2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H21N5O/c29-23(27-22-15-25-13-18-12-24-8-5-20(18)22)16-6-9-28(10-7-16)19-11-17-3-1-2-4-21(17)26-14-19/h1-5,8,11-16H,6-7,9-10H2,(H,27,29) |
| InChIKey | LIZBGAUFBPPYAM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |