C23H21N3O5S — CID 11626589
3-[5-(benzenesulfonamido)benzimidazol-1-yl]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 11626589) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is 3-[5-(benzenesulfonamido)benzimidazol-1-yl]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-[5-(benzenesulfonamido)benzimidazol-1-yl]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 11626589 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-[5-(benzenesulfonamido)benzimidazol-1-yl]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)n2cnc3cc(NS(=O)(=O)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C23H21N3O5S/c1-31-18-10-7-16(8-11-18)22(14-23(27)28)26-15-24-20-13-17(9-12-21(20)26)25-32(29,30)19-5-3-2-4-6-19/h2-13,15,22,25H,14H2,1H3,(H,27,28) |
| InChIKey | OWMYNCPEEQQBPU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |