C26H30FN3O4S — CID 11627449
1-[(3S,3aS)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-8-fluoro-3-phenyl-3a,4-dihydropyrazolo[5,1-c][1,4]benzoxazin-2-yl]ethanone (PubChem CID 11627449) has the molecular formula C26H30FN3O4S and a molecular weight of 499.61 g/mol. Its IUPAC name is 1-[(3S,3aS)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-8-fluoro-3-phenyl-3a,4-dihydropyrazolo[5,1-c][1,4]benzoxazin-2-yl]ethanone.
| Compound Name | 1-[(3S,3aS)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-8-fluoro-3-phenyl-3a,4-dihydropyrazolo[5,1-c][1,4]benzoxazin-2-yl]ethanone |
|---|---|
| PubChem CID | 11627449 |
| Molecular Formula | C26H30FN3O4S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 1-[(3S,3aS)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-8-fluoro-3-phenyl-3a,4-dihydropyrazolo[5,1-c][1,4]benzoxazin-2-yl]ethanone |
| SMILES | CC(=O)C1=NN2c3cc(F)ccc3OC[C@@H]2[C@]1(CCCCN1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H30FN3O4S/c1-19(31)25-26(20-7-3-2-4-8-20,11-5-6-12-29-13-15-35(32,33)16-14-29)24-18-34-23-10-9-21(27)17-22(23)30(24)28-25/h2-4,7-10,17,24H,5-6,11-16,18H2,1H3/t24-,26+/m1/s1 |
| InChIKey | DHJQQJDWIIERIG-RSXGOPAZSA-N |
| XLogP | 3.19 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|