C33H31NO2P2 — CID 11627991
N-[bis(diphenylphosphoryl)methyl]-2,6-dimethylaniline (PubChem CID 11627991) has the molecular formula C33H31NO2P2 and a molecular weight of 535.56 g/mol. Its IUPAC name is N-[bis(diphenylphosphoryl)methyl]-2,6-dimethylaniline.
| Compound Name | N-[bis(diphenylphosphoryl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 11627991 |
| Molecular Formula | C33H31NO2P2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[bis(diphenylphosphoryl)methyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NC(P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31NO2P2/c1-26-16-15-17-27(2)32(26)34-33(37(35,28-18-7-3-8-19-28)29-20-9-4-10-21-29)38(36,30-22-11-5-12-23-30)31-24-13-6-14-25-31/h3-25,33-34H,1-2H3 |
| InChIKey | WIBYHFTTXUNCQP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|