C12H15N — CID 13071317
N-but-3-yn-2-yl-2,6-dimethylaniline (PubChem CID 13071317) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,6-dimethylaniline.
| Compound Name | N-but-3-yn-2-yl-2,6-dimethylaniline |
|---|---|
| PubChem CID | 13071317 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-but-3-yn-2-yl-2,6-dimethylaniline |
| SMILES | C#CC(C)Nc1c(C)cccc1C |
| InChI | InChI=1S/C12H15N/c1-5-11(4)13-12-9(2)7-6-8-10(12)3/h1,6-8,11,13H,2-4H3 |
| InChIKey | ABXYTSMRTSIYJE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|