C18H22O2S — CID 11630844
1-[3-[3-(cyclohexen-1-yl)prop-2-ynylsulfonyl]propa-1,2-dienyl]cyclohexene (PubChem CID 11630844) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-[3-[3-(cyclohexen-1-yl)prop-2-ynylsulfonyl]propa-1,2-dienyl]cyclohexene.
| Compound Name | 1-[3-[3-(cyclohexen-1-yl)prop-2-ynylsulfonyl]propa-1,2-dienyl]cyclohexene |
|---|---|
| PubChem CID | 11630844 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[3-[3-(cyclohexen-1-yl)prop-2-ynylsulfonyl]propa-1,2-dienyl]cyclohexene |
| SMILES | O=S(=O)(C=C=CC1=CCCCC1)CC#CC1=CCCCC1 |
| InChI | InChI=1S/C18H22O2S/c19-21(20,15-7-13-17-9-3-1-4-10-17)16-8-14-18-11-5-2-6-12-18/h9,11,13,15H,1-6,10,12,16H2 |
| InChIKey | OGGHRSFVUYKXRT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|