C15H22F3NO9 — CID 11633076
methyl (2R,4S,5R,6R)-4-hydroxy-2-prop-2-enoxy-5-[(2,2,2-trifluoroacetyl)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 11633076) has the molecular formula C15H22F3NO9 and a molecular weight of 417.33 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-hydroxy-2-prop-2-enoxy-5-[(2,2,2-trifluoroacetyl)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-hydroxy-2-prop-2-enoxy-5-[(2,2,2-trifluoroacetyl)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11633076 |
| Molecular Formula | C15H22F3NO9 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-hydroxy-2-prop-2-enoxy-5-[(2,2,2-trifluoroacetyl)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | C=CCO[C@]1(C(=O)OC)C[C@H](O)[C@@H](NC(=O)C(F)(F)F)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C15H22F3NO9/c1-3-4-27-14(13(25)26-2)5-7(21)9(19-12(24)15(16,17)18)11(28-14)10(23)8(22)6-20/h3,7-11,20-23H,1,4-6H2,2H3,(H,19,24)/t7-,8+,9+,10+,11+,14+/m0/s1 |
| InChIKey | OSXAMPVUMKOPFJ-DLWUKCBXSA-N |
| XLogP | -2.03 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|