C24H13ClF4O3 — CID 11634001
(5Z)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-3-(2-fluoro-4-phenylphenyl)oxolane-2,4-dione (PubChem CID 11634001) has the molecular formula C24H13ClF4O3 and a molecular weight of 460.81 g/mol. Its IUPAC name is (5Z)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-3-(2-fluoro-4-phenylphenyl)oxolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-3-(2-fluoro-4-phenylphenyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11634001 |
| Molecular Formula | C24H13ClF4O3 |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | (5Z)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-3-(2-fluoro-4-phenylphenyl)oxolane-2,4-dione |
| SMILES | O=C1O/C(=C\c2cc(C(F)(F)F)ccc2Cl)C(=O)C1c1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C24H13ClF4O3/c25-18-9-7-16(24(27,28)29)10-15(18)12-20-22(30)21(23(31)32-20)17-8-6-14(11-19(17)26)13-4-2-1-3-5-13/h1-12,21H/b20-12- |
| InChIKey | GUHZAEQFOCHXAH-NDENLUEZSA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|