C23H15F4NO2 — CID 54501913
2-[(2-fluoronaphthalen-1-yl)methylidene]-5-methylimino-4-[3-(trifluoromethyl)phenyl]oxolan-3-one (PubChem CID 54501913) has the molecular formula C23H15F4NO2 and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-[(2-fluoronaphthalen-1-yl)methylidene]-5-methylimino-4-[3-(trifluoromethyl)phenyl]oxolan-3-one.
| Compound Name | 2-[(2-fluoronaphthalen-1-yl)methylidene]-5-methylimino-4-[3-(trifluoromethyl)phenyl]oxolan-3-one |
|---|---|
| PubChem CID | 54501913 |
| Molecular Formula | C23H15F4NO2 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[(2-fluoronaphthalen-1-yl)methylidene]-5-methylimino-4-[3-(trifluoromethyl)phenyl]oxolan-3-one |
| SMILES | C/N=C1\OC(=Cc2c(F)ccc3ccccc23)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F4NO2/c1-28-22-20(14-6-4-7-15(11-14)23(25,26)27)21(29)19(30-22)12-17-16-8-3-2-5-13(16)9-10-18(17)24/h2-12,20H,1H3/b19-12?,28-22- |
| InChIKey | YDAGMZQRWLOWTG-IOKMEBGSSA-N |
| XLogP | 5.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|