C18H21NO5S — CID 11639156
N-[[6-(benzenesulfonyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-methoxyethanamine (PubChem CID 11639156) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[[6-(benzenesulfonyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[6-(benzenesulfonyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 11639156 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[[6-(benzenesulfonyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1COc2ccc(S(=O)(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C18H21NO5S/c1-22-10-9-19-12-14-13-23-17-8-7-16(11-18(17)24-14)25(20,21)15-5-3-2-4-6-15/h2-8,11,14,19H,9-10,12-13H2,1H3 |
| InChIKey | QVJHAGOVRCIPRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|