C11H11F2NO3 — CID 11644413
(Z)-4,4-difluoro-3-methyl-1-(4-nitrophenyl)but-2-en-1-ol (PubChem CID 11644413) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is (Z)-4,4-difluoro-3-methyl-1-(4-nitrophenyl)but-2-en-1-ol.
| Compound Name | (Z)-4,4-difluoro-3-methyl-1-(4-nitrophenyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 11644413 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (Z)-4,4-difluoro-3-methyl-1-(4-nitrophenyl)but-2-en-1-ol |
| SMILES | C/C(=C/C(O)c1ccc([N+](=O)[O-])cc1)C(F)F |
| InChI | InChI=1S/C11H11F2NO3/c1-7(11(12)13)6-10(15)8-2-4-9(5-3-8)14(16)17/h2-6,10-11,15H,1H3/b7-6- |
| InChIKey | VXIHBJISZIZLPA-SREVYHEPSA-N |
| XLogP | 2.84 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|