C16H14N2O2 — CID 11644682
2-(4-methylphenyl)-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 11644682) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | 2-(4-methylphenyl)-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 11644682 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(4-methylphenyl)-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3C2C(N)=O)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-10-6-8-11(9-7-10)18-14(15(17)19)12-4-2-3-5-13(12)16(18)20/h2-9,14H,1H3,(H2,17,19) |
| InChIKey | ZRBWJLWUCGHMAE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |