C18H36O2Si — CID 11645298
(2R,3S)-2-heptyl-2-triethylsilylpent-4-yne-1,3-diol (PubChem CID 11645298) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2R,3S)-2-heptyl-2-triethylsilylpent-4-yne-1,3-diol.
| Compound Name | (2R,3S)-2-heptyl-2-triethylsilylpent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 11645298 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2R,3S)-2-heptyl-2-triethylsilylpent-4-yne-1,3-diol |
| SMILES | C#C[C@H](O)[C@](CO)(CCCCCCC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H36O2Si/c1-6-11-12-13-14-15-18(16-19,17(20)7-2)21(8-3,9-4)10-5/h2,17,19-20H,6,8-16H2,1,3-5H3/t17-,18+/m0/s1 |
| InChIKey | HMOKMOWROLDWKE-ZWKOTPCHSA-N |
| XLogP | 4.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|