C32H47NO4Si — CID 11649533
tert-butyl N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-[2-(hydroxymethyl)cyclohexen-1-yl]butan-2-yl]carbamate (PubChem CID 11649533) has the molecular formula C32H47NO4Si and a molecular weight of 537.82 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-[2-(hydroxymethyl)cyclohexen-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-[2-(hydroxymethyl)cyclohexen-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11649533 |
| Molecular Formula | C32H47NO4Si |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | tert-butyl N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-[2-(hydroxymethyl)cyclohexen-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC1=C(CO)CCCC1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H47NO4Si/c1-31(2,3)37-30(35)33-27(22-21-25-15-13-14-16-26(25)23-34)24-36-38(32(4,5)6,28-17-9-7-10-18-28)29-19-11-8-12-20-29/h7-12,17-20,27,34H,13-16,21-24H2,1-6H3,(H,33,35)/t27-/m1/s1 |
| InChIKey | GMOKROAJXQJTNJ-HHHXNRCGSA-N |
| XLogP | 6.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|