C14H21ClO2 — CID 116500248
2-[(2-chlorophenyl)methyl]-5-methoxy-3-methylpentan-1-ol (PubChem CID 116500248) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-methoxy-3-methylpentan-1-ol.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-methoxy-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 116500248 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-methoxy-3-methylpentan-1-ol |
| SMILES | COCCC(C)C(CO)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClO2/c1-11(7-8-17-2)13(10-16)9-12-5-3-4-6-14(12)15/h3-6,11,13,16H,7-10H2,1-2H3 |
| InChIKey | HTUZGPNOPWBEEM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |