C10H18O2S — CID 116504683
1-(3,4-dihydro-2H-pyran-5-yl)-3-ethylsulfanylpropan-1-ol (PubChem CID 116504683) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethylsulfanylpropan-1-ol.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 116504683 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethylsulfanylpropan-1-ol |
| SMILES | CCSCCC(O)C1=COCCC1 |
| InChI | InChI=1S/C10H18O2S/c1-2-13-7-5-10(11)9-4-3-6-12-8-9/h8,10-11H,2-7H2,1H3 |
| InChIKey | QVTCTBJWFVWEOD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|