C38H50N2O7Si — CID 11650480
benzyl N-[(1S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl]carbamate (PubChem CID 11650480) has the molecular formula C38H50N2O7Si and a molecular weight of 674.91 g/mol. Its IUPAC name is benzyl N-[(1S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 11650480 |
| Molecular Formula | C38H50N2O7Si |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | benzyl N-[(1S,5R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl]carbamate |
| SMILES | COCO[C@@H]1C=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](NC(=O)OCc2ccccc2)[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H50N2O7Si/c1-37(2,3)47-36(42)40-34-32(39-35(41)44-25-28-17-11-8-12-18-28)23-29(24-33(34)45-27-43-7)26-46-48(38(4,5)6,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-22,24,32-34H,23,25-27H2,1-7H3,(H,39,41)(H,40,42)/t32-,33+,34+/m0/s1 |
| InChIKey | OBFGWJODPAEGNV-LBFZIJHGSA-N |
| XLogP | 6.07 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|