C8H16O3S — CID 116505038
5-ethylsulfanyl-3-hydroxy-2-methylpentanoic acid (PubChem CID 116505038) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is 5-ethylsulfanyl-3-hydroxy-2-methylpentanoic acid.
| Compound Name | 5-ethylsulfanyl-3-hydroxy-2-methylpentanoic acid |
|---|---|
| PubChem CID | 116505038 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-ethylsulfanyl-3-hydroxy-2-methylpentanoic acid |
| SMILES | CCSCCC(O)C(C)C(=O)O |
| InChI | InChI=1S/C8H16O3S/c1-3-12-5-4-7(9)6(2)8(10)11/h6-7,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | AGLGRRDHJSDTLV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|