C9H16O3S — CID 135057044
(2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylsulfanylpentanoic acid (PubChem CID 135057044) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylsulfanylpentanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 135057044 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylsulfanylpentanoic acid |
| SMILES | C=CCS[C@](C)(C(=O)O)[C@H](O)CC |
| InChI | InChI=1S/C9H16O3S/c1-4-6-13-9(3,8(11)12)7(10)5-2/h4,7,10H,1,5-6H2,2-3H3,(H,11,12)/t7-,9+/m1/s1 |
| InChIKey | CGMQRZKRHUNWNZ-APPZFPTMSA-N |
| XLogP | 1.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|