5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid

C9H18O3S — CID 116505042

IUPAC5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid
SMILESCCSCCC(O)C(C)(C)C(=O)O
InChIInChI=1S/C9H18O3S/c1-4-13-6-5-7(10)9(2,3)8(11)12/h7,10H,4-6H2,1-3H3,(H,11,12)
InChIKeyRPJWFYUAVFAPDG-UHFFFAOYSA-N
MW206.31 g/mol
LogP1.60
Rot. Bonds6

About 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid

5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid (PubChem CID 116505042) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid.

Molecular Properties

Compound Name5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid
PubChem CID116505042
Molecular FormulaC9H18O3S
Molecular Weight206.31 g/mol
Exact Mass206.10
IUPAC Name5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid
SMILESCCSCCC(O)C(C)(C)C(=O)O
InChIInChI=1S/C9H18O3S/c1-4-13-6-5-7(10)9(2,3)8(11)12/h7,10H,4-6H2,1-3H3,(H,11,12)
InChIKeyRPJWFYUAVFAPDG-UHFFFAOYSA-N
XLogP1.60
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.31
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid?
The IUPAC name of 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid (CID 116505042) is 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid.
What is the SMILES notation for 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid?
The canonical SMILES for 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid is CCSCCC(O)C(C)(C)C(=O)O.
What is the InChIKey of 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid?
The InChIKey is RPJWFYUAVFAPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3S/c1-4-13-6-5-7(10)9(2,3)8(11)12/h7,10H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid?
5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid has a molecular weight of 206.31 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-3-hydroxy-2,2-dimethylpentanoic acid is sourced from PubChem (CID 116505042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).