C16H24N4 — CID 116513416
N-amino-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide (PubChem CID 116513416) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-amino-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-amino-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 116513416 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-amino-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
| SMILES | NN/C(=N\c1ccccc1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H24N4/c17-19-16(18-15-8-2-1-3-9-15)20-11-10-13-6-4-5-7-14(13)12-20/h1-3,8-9,13-14H,4-7,10-12,17H2,(H,18,19) |
| InChIKey | DYVAOLFODMHWET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|