C15H21N3 — CID 78967114
N'-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide (PubChem CID 78967114) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N'-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide.
| Compound Name | N'-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 78967114 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N'-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H21N3/c16-15(17-13-7-2-1-3-8-13)18-11-10-12-6-4-5-9-14(12)18/h1-3,7-8,12,14H,4-6,9-11H2,(H2,16,17) |
| InChIKey | HZCJXCHEFNAVLY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|