C15H20N2 — CID 78967127
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl(phenyl)methanimine (PubChem CID 78967127) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl(phenyl)methanimine.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl(phenyl)methanimine |
|---|---|
| PubChem CID | 78967127 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl(phenyl)methanimine |
| SMILES | [H]/N=C(\c1ccccc1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H20N2/c16-15(13-7-2-1-3-8-13)17-11-10-12-6-4-5-9-14(12)17/h1-3,7-8,12,14,16H,4-6,9-11H2/b16-15+ |
| InChIKey | BYPIRYNYMJQOAS-FOCLMDBBSA-N |
| XLogP | 3.28 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|