C16H23N3 — CID 102726813
(4aR,8aR)-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide (PubChem CID 102726813) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (4aR,8aR)-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide.
| Compound Name | (4aR,8aR)-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 102726813 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (4aR,8aR)-N'-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H23N3/c17-16(18-14-9-2-1-3-10-14)19-12-6-8-13-7-4-5-11-15(13)19/h1-3,9-10,13,15H,4-8,11-12H2,(H2,17,18)/t13-,15-/m1/s1 |
| InChIKey | ZZEHNXZSOBKGSP-UKRRQHHQSA-N |
| XLogP | 3.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|