C15H22N4 — CID 62362512
4-(cyclopropylmethyl)-N'-phenylpiperazine-1-carboximidamide (PubChem CID 62362512) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-N'-phenylpiperazine-1-carboximidamide.
| Compound Name | 4-(cyclopropylmethyl)-N'-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62362512 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-(cyclopropylmethyl)-N'-phenylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C15H22N4/c16-15(17-14-4-2-1-3-5-14)19-10-8-18(9-11-19)12-13-6-7-13/h1-5,13H,6-12H2,(H2,16,17) |
| InChIKey | OJYVSRAKIJDYGC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|