C15H27N5 — CID 116514213
1-amino-2-[4-[methyl(propan-2-yl)amino]butyl]-3-phenylguanidine (PubChem CID 116514213) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-amino-2-[4-[methyl(propan-2-yl)amino]butyl]-3-phenylguanidine.
| Compound Name | 1-amino-2-[4-[methyl(propan-2-yl)amino]butyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 116514213 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-amino-2-[4-[methyl(propan-2-yl)amino]butyl]-3-phenylguanidine |
| SMILES | CC(C)N(C)CCCC/N=C(\NN)Nc1ccccc1 |
| InChI | InChI=1S/C15H27N5/c1-13(2)20(3)12-8-7-11-17-15(19-16)18-14-9-5-4-6-10-14/h4-6,9-10,13H,7-8,11-12,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | VGANKPXUFPFUIP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|