C13H21FN4O — CID 116515016
1-amino-3-[1-(4-fluorophenyl)propan-2-yl]-2-(2-methoxyethyl)guanidine (PubChem CID 116515016) has the molecular formula C13H21FN4O and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-amino-3-[1-(4-fluorophenyl)propan-2-yl]-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-amino-3-[1-(4-fluorophenyl)propan-2-yl]-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 116515016 |
| Molecular Formula | C13H21FN4O |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-amino-3-[1-(4-fluorophenyl)propan-2-yl]-2-(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(\NN)NC(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN4O/c1-10(9-11-3-5-12(14)6-4-11)17-13(18-15)16-7-8-19-2/h3-6,10H,7-9,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | INTCKYAKCJYDFJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|