C14H23FN4O — CID 116515866
1-amino-2-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(1-methoxypropan-2-yl)guanidine (PubChem CID 116515866) has the molecular formula C14H23FN4O and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-amino-2-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-amino-2-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 116515866 |
| Molecular Formula | C14H23FN4O |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-amino-2-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(=N/CCc1ccc(F)cc1C)NN |
| InChI | InChI=1S/C14H23FN4O/c1-10-8-13(15)5-4-12(10)6-7-17-14(19-16)18-11(2)9-20-3/h4-5,8,11H,6-7,9,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | AESRWPDXDYGXQK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|