C12H18ClFN4O — CID 116511059
1-amino-2-[(3-chloro-4-fluorophenyl)methyl]-3-(1-methoxypropan-2-yl)guanidine (PubChem CID 116511059) has the molecular formula C12H18ClFN4O and a molecular weight of 288.75 g/mol. Its IUPAC name is 1-amino-2-[(3-chloro-4-fluorophenyl)methyl]-3-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-amino-2-[(3-chloro-4-fluorophenyl)methyl]-3-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 116511059 |
| Molecular Formula | C12H18ClFN4O |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-amino-2-[(3-chloro-4-fluorophenyl)methyl]-3-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(=N/Cc1ccc(F)c(Cl)c1)NN |
| InChI | InChI=1S/C12H18ClFN4O/c1-8(7-19-2)17-12(18-15)16-6-9-3-4-11(14)10(13)5-9/h3-5,8H,6-7,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | KJXBRQKGSDTPSZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|