C15H16O2 — CID 11651530
3,8-dimethyl-2,3,4,9-tetrahydroxanthen-1-one (PubChem CID 11651530) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,8-dimethyl-2,3,4,9-tetrahydroxanthen-1-one.
| Compound Name | 3,8-dimethyl-2,3,4,9-tetrahydroxanthen-1-one |
|---|---|
| PubChem CID | 11651530 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3,8-dimethyl-2,3,4,9-tetrahydroxanthen-1-one |
| SMILES | Cc1cccc2c1CC1=C(CC(C)CC1=O)O2 |
| InChI | InChI=1S/C15H16O2/c1-9-6-13(16)12-8-11-10(2)4-3-5-14(11)17-15(12)7-9/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | IENSRVSDDGGPLF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |