About carbon dioxide;5-methyl-4H-chromen-3-one
carbon dioxide;5-methyl-4H-chromen-3-one (PubChem CID 123220756) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is carbon dioxide;5-methyl-4H-chromen-3-one.
Molecular Properties
| Compound Name | carbon dioxide;5-methyl-4H-chromen-3-one |
| PubChem CID | 123220756 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | carbon dioxide;5-methyl-4H-chromen-3-one |
| SMILES | Cc1cccc2c1CC(=O)CO2.O=C=O |
| InChI | InChI=1S/C10H10O2.CO2/c1-7-3-2-4-10-9(7)5-8(11)6-12-10;2-1-3/h2-4H,5-6H2,1H3; |
| InChIKey | CZQNGBPZMCIIGN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;5-methyl-4H-chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;5-methyl-4H-chromen-3-one?
The IUPAC name of carbon dioxide;5-methyl-4H-chromen-3-one (CID 123220756) is carbon dioxide;5-methyl-4H-chromen-3-one.
What is the SMILES notation for carbon dioxide;5-methyl-4H-chromen-3-one?
The canonical SMILES for carbon dioxide;5-methyl-4H-chromen-3-one is Cc1cccc2c1CC(=O)CO2.O=C=O.
What is the InChIKey of carbon dioxide;5-methyl-4H-chromen-3-one?
The InChIKey is CZQNGBPZMCIIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.CO2/c1-7-3-2-4-10-9(7)5-8(11)6-12-10;2-1-3/h2-4H,5-6H2,1H3;.
What are the key properties of carbon dioxide;5-methyl-4H-chromen-3-one?
carbon dioxide;5-methyl-4H-chromen-3-one has a molecular weight of 206.20 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;5-methyl-4H-chromen-3-one is sourced from PubChem (CID 123220756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).