C11H14O2 — CID 170038060
7-methyl-2,3,5,6-tetrahydro-1,4-benzodioxocine (PubChem CID 170038060) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-methyl-2,3,5,6-tetrahydro-1,4-benzodioxocine.
| Compound Name | 7-methyl-2,3,5,6-tetrahydro-1,4-benzodioxocine |
|---|---|
| PubChem CID | 170038060 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 7-methyl-2,3,5,6-tetrahydro-1,4-benzodioxocine |
| SMILES | Cc1cccc2c1CCOCCO2 |
| InChI | InChI=1S/C11H14O2/c1-9-3-2-4-11-10(9)5-6-12-7-8-13-11/h2-4H,5-8H2,1H3 |
| InChIKey | WGFUTCBACIUACF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |