C9H18N6O — CID 116515322
1-amino-3-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]guanidine (PubChem CID 116515322) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-amino-3-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]guanidine.
| Compound Name | 1-amino-3-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 116515322 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-amino-3-(2-methoxyethyl)-2-[(1-methylimidazol-2-yl)methyl]guanidine |
| SMILES | COCCN/C(=N\Cc1nccn1C)NN |
| InChI | InChI=1S/C9H18N6O/c1-15-5-3-11-8(15)7-13-9(14-10)12-4-6-16-2/h3,5H,4,6-7,10H2,1-2H3,(H2,12,13,14) |
| InChIKey | XNXQJKNYYJZXSC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|